About quinoline-3-carboxamide
quinoline-3-carboxamide (PubChem CID 15561101) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is quinoline-3-carboxamide.
Molecular Properties
| Compound Name | quinoline-3-carboxamide |
| PubChem CID | 15561101 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | quinoline-3-carboxamide |
| SMILES | NC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H8N2O/c11-10(13)8-5-7-3-1-2-4-9(7)12-6-8/h1-6H,(H2,11,13) |
| InChIKey | BLTDCIWCFCUQCB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-3-carboxamide?
The IUPAC name of quinoline-3-carboxamide (CID 15561101) is quinoline-3-carboxamide.
What is the SMILES notation for quinoline-3-carboxamide?
The canonical SMILES for quinoline-3-carboxamide is NC(=O)c1cnc2ccccc2c1.
What is the InChIKey of quinoline-3-carboxamide?
The InChIKey is BLTDCIWCFCUQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c11-10(13)8-5-7-3-1-2-4-9(7)12-6-8/h1-6H,(H2,11,13).
What are the key properties of quinoline-3-carboxamide?
quinoline-3-carboxamide has a molecular weight of 172.19 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-3-carboxamide is sourced from PubChem (CID 15561101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).