C48H57IrN3OSi-2 — CID 155612745
2-tert-butyl-8-[4-(cyclohexylmethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 155612745) has the molecular formula C48H57IrN3OSi-2 and a molecular weight of 912.31 g/mol. Its IUPAC name is 2-tert-butyl-8-[4-(cyclohexylmethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-tert-butyl-8-[4-(cyclohexylmethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 155612745 |
| Molecular Formula | C48H57IrN3OSi-2 |
| Molecular Weight | 912.31 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | 2-tert-butyl-8-[4-(cyclohexylmethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)c1ccc2c(n1)oc1c(-c3cc(CC4CCCCC4)ccn3)[c-]ccc12.C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1CC1CCCCC1.[Ir] |
| InChI | InChI=1S/C27H29N2O.C21H28NSi.Ir/c1-27(2,3)24-13-12-21-20-10-7-11-22(25(20)30-26(21)29-24)23-17-19(14-15-28-23)16-18-8-5-4-6-9-18;1-23(2,3)21-16-22-20(18-12-8-5-9-13-18)15-19(21)14-17-10-6-4-7-11-17;/h7,10,12-15,17-18H,4-6,8-9,16H2,1-3H3;5,8-9,12,15-17H,4,6-7,10-11,14H2,1-3H3;/q2*-1; |
| InChIKey | QRAWVKVQWYGSRG-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.31 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|