About 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide
2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide (PubChem CID 155612825) has the molecular formula C10H14FN5O
and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide |
| PubChem CID | 155612825 |
| Molecular Formula | C10H14FN5O |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(N[C@@H]2CCNC[C@@H]2F)n1 |
| InChI | InChI=1S/C10H14FN5O/c11-6-5-13-3-1-7(6)15-10-14-4-2-8(16-10)9(12)17/h2,4,6-7,13H,1,3,5H2,(H2,12,17)(H,14,15,16)/t6-,7+/m0/s1 |
| InChIKey | VUPCAJQDXDXUMO-NKWVEPMBSA-N |
| XLogP | -0.31 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide?
The IUPAC name of 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide (CID 155612825) is 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide.
What is the SMILES notation for 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide?
The canonical SMILES for 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide is NC(=O)c1ccnc(N[C@@H]2CCNC[C@@H]2F)n1.
What is the InChIKey of 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide?
The InChIKey is VUPCAJQDXDXUMO-NKWVEPMBSA-N. The full InChI is InChI=1S/C10H14FN5O/c11-6-5-13-3-1-7(6)15-10-14-4-2-8(16-10)9(12)17/h2,4,6-7,13H,1,3,5H2,(H2,12,17)(H,14,15,16)/t6-,7+/m0/s1.
What are the key properties of 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide?
2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide has a molecular weight of 239.25 g/mol, XLogP of -0.31, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]pyrimidine-4-carboxamide is sourced from PubChem (CID 155612825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).