About 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+)
2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) (PubChem CID 155612950) has the molecular formula C13H21NW
and a molecular weight of 375.16 g/mol. Its IUPAC name is 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+).
Molecular Properties
| Compound Name | 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) |
| PubChem CID | 155612950 |
| Molecular Formula | C13H21NW |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) |
| SMILES | CC(C)(C)c1c[c-]ccn1.C[C-](C)C.[W+2] |
| InChI | InChI=1S/C9H12N.C4H9.W/c1-9(2,3)8-6-4-5-7-10-8;1-4(2)3;/h5-7H,1-3H3;1-3H3;/q2*-1;+2 |
| InChIKey | XQUKWJXRZMVHHG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+)?
The IUPAC name of 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) (CID 155612950) is 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+).
What is the SMILES notation for 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+)?
The canonical SMILES for 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) is CC(C)(C)c1c[c-]ccn1.C[C-](C)C.[W+2].
What is the InChIKey of 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+)?
The InChIKey is XQUKWJXRZMVHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.C4H9.W/c1-9(2,3)8-6-4-5-7-10-8;1-4(2)3;/h5-7H,1-3H3;1-3H3;/q2*-1;+2.
What are the key properties of 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+)?
2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) has a molecular weight of 375.16 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4H-pyridin-4-ide;2-methylpropane;tungsten(2+) is sourced from PubChem (CID 155612950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).