C30H35F3N2 — CID 155613071
N-butyl-4-[(4-butylimino-3-methylcyclohexa-2,5-dien-1-ylidene)-[2-(trifluoromethyl)phenyl]methyl]-2-methylaniline (PubChem CID 155613071) has the molecular formula C30H35F3N2 and a molecular weight of 480.62 g/mol. Its IUPAC name is N-butyl-4-[(4-butylimino-3-methylcyclohexa-2,5-dien-1-ylidene)-[2-(trifluoromethyl)phenyl]methyl]-2-methylaniline.
| Compound Name | N-butyl-4-[(4-butylimino-3-methylcyclohexa-2,5-dien-1-ylidene)-[2-(trifluoromethyl)phenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 155613071 |
| Molecular Formula | C30H35F3N2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-butyl-4-[(4-butylimino-3-methylcyclohexa-2,5-dien-1-ylidene)-[2-(trifluoromethyl)phenyl]methyl]-2-methylaniline |
| SMILES | CCCC/N=C1\C=CC(=C(c2ccc(NCCCC)c(C)c2)c2ccccc2C(F)(F)F)C=C1C |
| InChI | InChI=1S/C30H35F3N2/c1-5-7-17-34-27-15-13-23(19-21(27)3)29(25-11-9-10-12-26(25)30(31,32)33)24-14-16-28(22(4)20-24)35-18-8-6-2/h9-16,19-20,34H,5-8,17-18H2,1-4H3/b29-24?,35-28+ |
| InChIKey | IERMNIYCPGUYLB-UJWCQDOGSA-N |
| XLogP | 8.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|