C8H12N4 — CID 155613335
4,5-diimino-3,6-dimethylcyclohexa-2,6-diene-1,2-diamine (PubChem CID 155613335) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 4,5-diimino-3,6-dimethylcyclohexa-2,6-diene-1,2-diamine.
| Compound Name | 4,5-diimino-3,6-dimethylcyclohexa-2,6-diene-1,2-diamine |
|---|---|
| PubChem CID | 155613335 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 4,5-diimino-3,6-dimethylcyclohexa-2,6-diene-1,2-diamine |
| SMILES | [H]/N=C1/C(C)=C(N)C(N)=C(C)/C1=N\[H] |
| InChI | InChI=1S/C8H12N4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h9,11H,10,12H2,1-2H3/b9-5-,11-7+ |
| InChIKey | UWXCWRUNBCSSFP-KGAZIEBHSA-N |
| XLogP | 0.50 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|