C15H19F3N4O4S2 — CID 155613720
2-[methyl(propylaminomethylsulfonyl)amino]-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 155613720) has the molecular formula C15H19F3N4O4S2 and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-[methyl(propylaminomethylsulfonyl)amino]-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | 2-[methyl(propylaminomethylsulfonyl)amino]-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 155613720 |
| Molecular Formula | C15H19F3N4O4S2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[methyl(propylaminomethylsulfonyl)amino]-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CCCNCS(=O)(=O)N(C)CC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C15H19F3N4O4S2/c1-3-6-19-9-28(24,25)22(2)8-13(23)21-14-20-11-5-4-10(7-12(11)27-14)26-15(16,17)18/h4-5,7,19H,3,6,8-9H2,1-2H3,(H,20,21,23) |
| InChIKey | FLQBSHXFUVMDIS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|