C25H26F3N5O6S — CID 155613792
N-[(3S)-2'-(5-methyl-1,2-oxazol-3-yl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide (PubChem CID 155613792) has the molecular formula C25H26F3N5O6S and a molecular weight of 581.57 g/mol. Its IUPAC name is N-[(3S)-2'-(5-methyl-1,2-oxazol-3-yl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3S)-2'-(5-methyl-1,2-oxazol-3-yl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 155613792 |
| Molecular Formula | C25H26F3N5O6S |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | N-[(3S)-2'-(5-methyl-1,2-oxazol-3-yl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
| SMILES | Cc1cc(-n2nc3c(c2NC(=O)CS(C)(=O)=O)C(=O)N[C@@]2(CCc4cc(OCCCC(F)(F)F)ccc42)C3)no1 |
| InChI | InChI=1S/C25H26F3N5O6S/c1-14-10-19(32-39-14)33-22(29-20(34)13-40(2,36)37)21-18(31-33)12-24(30-23(21)35)8-6-15-11-16(4-5-17(15)24)38-9-3-7-25(26,27)28/h4-5,10-11H,3,6-9,12-13H2,1-2H3,(H,29,34)(H,30,35)/t24-/m0/s1 |
| InChIKey | ZQRFLKAVGBJOOL-DEOSSOPVSA-N |
| XLogP | 3.00 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|