C10H14O2 — CID 15561422
(1R,3S,4S,5S,7R)-4-hydroxyadamantan-2-one (PubChem CID 15561422) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,3S,4S,5S,7R)-4-hydroxyadamantan-2-one.
| Compound Name | (1R,3S,4S,5S,7R)-4-hydroxyadamantan-2-one |
|---|---|
| PubChem CID | 15561422 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,3S,4S,5S,7R)-4-hydroxyadamantan-2-one |
| SMILES | O=C1[C@@H]2C[C@H]3C[C@@H](C2)[C@H](O)[C@@H]1C3 |
| InChI | InChI=1S/C10H14O2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-9,11H,1-4H2/t5-,6+,7-,8+,9+/m1/s1 |
| InChIKey | MDHZLHGRJCMNLA-DMAGGPPCSA-N |
| XLogP | 0.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |