C66H53N3 — CID 155614368
2-[9-[3-[9-[3-[4,5-dimethyl-9-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)fluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]pyridine (PubChem CID 155614368) has the molecular formula C66H53N3 and a molecular weight of 888.17 g/mol. Its IUPAC name is 2-[9-[3-[9-[3-[4,5-dimethyl-9-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)fluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]pyridine.
| Compound Name | 2-[9-[3-[9-[3-[4,5-dimethyl-9-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)fluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 155614368 |
| Molecular Formula | C66H53N3 |
| Molecular Weight | 888.17 g/mol |
| Exact Mass | 887.42 |
| IUPAC Name | 2-[9-[3-[9-[3-[4,5-dimethyl-9-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)fluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]phenyl]-4,5-dimethylfluoren-9-yl]pyridine |
| SMILES | Cc1cccc2c1-c1c(C)cccc1C2(c1cccc(C2(c3ccccn3)c3cccc(C)c3-c3c(C)cccc32)c1)c1cccc(C2(n3[c-][n+](C)cc3)c3cccc(C)c3-c3c(C)cccc32)c1 |
| InChI | InChI=1S/C66H53N3/c1-41-18-10-28-51-58(41)59-42(2)19-11-29-52(59)64(51,47-24-16-26-49(38-47)65(57-34-8-9-35-67-57)53-30-12-20-43(3)60(53)61-44(4)21-13-31-54(61)65)48-25-17-27-50(39-48)66(69-37-36-68(7)40-69)55-32-14-22-45(5)62(55)63-46(6)23-15-33-56(63)66/h8-39H,1-7H3 |
| InChIKey | WFDMYYAJIWBLQN-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.17 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|