C20H30FNO5 — CID 155614590
N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide (PubChem CID 155614590) has the molecular formula C20H30FNO5 and a molecular weight of 383.46 g/mol. Its IUPAC name is N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide.
| Compound Name | N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 155614590 |
| Molecular Formula | C20H30FNO5 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide |
| SMILES | CC(C)[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1NC(=O)CCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H30FNO5/c1-12(2)20-17(19(26)18(25)15(11-23)27-20)22-16(24)6-4-3-5-13-7-9-14(21)10-8-13/h7-10,12,15,17-20,23,25-26H,3-6,11H2,1-2H3,(H,22,24)/t15?,17?,18-,19-,20+/m1/s1 |
| InChIKey | ICSYMKCFHKDYCW-FLLWYEDFSA-N |
| XLogP | 1.16 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|