About CID 155616537
CID 155616537 (PubChem CID 155616537) has the molecular formula C40H29N4OPtS-3
and a molecular weight of 808.84 g/mol.
Molecular Properties
| Compound Name | CID 155616537 |
| PubChem CID | 155616537 |
| Molecular Formula | C40H29N4OPtS-3 |
| Molecular Weight | 808.84 g/mol |
| Exact Mass | 808.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)Sc4cccc6c4N5[CH-]N6c4ccccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C40H29N4OS.Pt/c1-40(2,3)26-20-21-41-38(22-26)44-32-13-8-7-12-30(32)31-18-16-28(23-34(31)44)45-29-17-19-36-35(24-29)43-25-42(27-10-5-4-6-11-27)33-14-9-15-37(46-36)39(33)43;/h4-22,25H,1-3H3;/q-3; |
| InChIKey | IFEGRFUQIULCLI-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 808.84 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 155616537 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155616537?
The IUPAC name of CID 155616537 (CID 155616537) is not available.
What is the SMILES notation for CID 155616537?
The canonical SMILES for CID 155616537 is CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)Sc4cccc6c4N5[CH-]N6c4ccccc4)ccc3c3ccccc32)c1.[Pt].
What is the InChIKey of CID 155616537?
The InChIKey is IFEGRFUQIULCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H29N4OS.Pt/c1-40(2,3)26-20-21-41-38(22-26)44-32-13-8-7-12-30(32)31-18-16-28(23-34(31)44)45-29-17-19-36-35(24-29)43-25-42(27-10-5-4-6-11-27)33-14-9-15-37(46-36)39(33)43;/h4-22,25H,1-3H3;/q-3;.
What are the key properties of CID 155616537?
CID 155616537 has a molecular weight of 808.84 g/mol, XLogP of 10.74, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155616537 is sourced from PubChem (CID 155616537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).