C31H58O7Si — CID 155616986
tert-butyl-[(2E,4E,6S,7S,8E,10S,11S)-11-methoxy-6,10-dimethyl-2-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]trideca-2,4,8-trien-7-yl]oxy-dimethylsilane (PubChem CID 155616986) has the molecular formula C31H58O7Si and a molecular weight of 570.88 g/mol. Its IUPAC name is tert-butyl-[(2E,4E,6S,7S,8E,10S,11S)-11-methoxy-6,10-dimethyl-2-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]trideca-2,4,8-trien-7-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4E,6S,7S,8E,10S,11S)-11-methoxy-6,10-dimethyl-2-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]trideca-2,4,8-trien-7-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 155616986 |
| Molecular Formula | C31H58O7Si |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | tert-butyl-[(2E,4E,6S,7S,8E,10S,11S)-11-methoxy-6,10-dimethyl-2-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]trideca-2,4,8-trien-7-yl]oxy-dimethylsilane |
| SMILES | CC[C@H](OC)[C@@H](C)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=C(\C)[C@H]1O[C@H](OC)[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C31H58O7Si/c1-15-24(32-8)22(3)19-20-25(38-39(13,14)31(5,6)7)21(2)17-16-18-23(4)26-27(33-9)28(34-10)29(35-11)30(36-12)37-26/h16-22,24-30H,15H2,1-14H3/b17-16+,20-19+,23-18+/t21-,22-,24-,25-,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | KLTKIZOTVGVBTE-FJQJZFAHSA-N |
| XLogP | 6.55 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|