C19H35LiN2 — CID 155617675
lithium 1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine (PubChem CID 155617675) has the molecular formula C19H35LiN2 and a molecular weight of 298.44 g/mol. Its IUPAC name is lithium 1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine.
| Compound Name | lithium 1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 155617675 |
| Molecular Formula | C19H35LiN2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | lithium 1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine |
| SMILES | [CH2-]/C(=C/CCCCC)CC/C=C(\C)CN1CCN(C)CC1.[Li+] |
| InChI | InChI=1S/C19H35N2.Li/c1-5-6-7-8-10-18(2)11-9-12-19(3)17-21-15-13-20(4)14-16-21;/h10,12H,2,5-9,11,13-17H2,1,3-4H3;/q-1;+1/b18-10-,19-12+; |
| InChIKey | RRTPPQMVMJORSK-VLGJSVMOSA-N |
| XLogP | 1.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|