C34H62N4 — CID 155617679
1-[(2E,6Z,10Z)-2,6-dimethyl-10-[(E)-4-methyl-5-(4-methylpiperazin-1-yl)pent-3-enyl]hexadeca-2,6,10-trienyl]-4-methylpiperazine (PubChem CID 155617679) has the molecular formula C34H62N4 and a molecular weight of 526.90 g/mol. Its IUPAC name is 1-[(2E,6Z,10Z)-2,6-dimethyl-10-[(E)-4-methyl-5-(4-methylpiperazin-1-yl)pent-3-enyl]hexadeca-2,6,10-trienyl]-4-methylpiperazine.
| Compound Name | 1-[(2E,6Z,10Z)-2,6-dimethyl-10-[(E)-4-methyl-5-(4-methylpiperazin-1-yl)pent-3-enyl]hexadeca-2,6,10-trienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 155617679 |
| Molecular Formula | C34H62N4 |
| Molecular Weight | 526.90 g/mol |
| Exact Mass | 526.50 |
| IUPAC Name | 1-[(2E,6Z,10Z)-2,6-dimethyl-10-[(E)-4-methyl-5-(4-methylpiperazin-1-yl)pent-3-enyl]hexadeca-2,6,10-trienyl]-4-methylpiperazine |
| SMILES | CCCCC/C=C(/CC/C=C(/C)CC/C=C(\C)CN1CCN(C)CC1)CC/C=C(\C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C34H62N4/c1-7-8-9-10-18-34(20-13-17-33(4)30-38-27-23-36(6)24-28-38)19-12-15-31(2)14-11-16-32(3)29-37-25-21-35(5)22-26-37/h15-18H,7-14,19-30H2,1-6H3/b31-15-,32-16+,33-17+,34-18- |
| InChIKey | HASBJFYJNOSONU-GGHOBVFWSA-N |
| XLogP | 7.17 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.90 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|