About 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride
4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride (PubChem CID 15561769) has the molecular formula C16H17Cl2N3O
and a molecular weight of 338.24 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride |
| PubChem CID | 15561769 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride |
| SMILES | Cl.Cl/C(=N\c1ccccc1)c1cc(N2CCOCC2)ccn1 |
| InChI | InChI=1S/C16H16ClN3O.ClH/c17-16(19-13-4-2-1-3-5-13)15-12-14(6-7-18-15)20-8-10-21-11-9-20;/h1-7,12H,8-11H2;1H/b19-16-; |
| InChIKey | ZPISZDRNKZNRHY-JWJVXZKMSA-N |
| XLogP | 3.66 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride?
The IUPAC name of 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride (CID 15561769) is 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride.
What is the SMILES notation for 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride?
The canonical SMILES for 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride is Cl.Cl/C(=N\c1ccccc1)c1cc(N2CCOCC2)ccn1.
What is the InChIKey of 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride?
The InChIKey is ZPISZDRNKZNRHY-JWJVXZKMSA-N. The full InChI is InChI=1S/C16H16ClN3O.ClH/c17-16(19-13-4-2-1-3-5-13)15-12-14(6-7-18-15)20-8-10-21-11-9-20;/h1-7,12H,8-11H2;1H/b19-16-;.
What are the key properties of 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride?
4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride has a molecular weight of 338.24 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-yl-N-phenylpyridine-2-carboximidoyl chloride;hydrochloride is sourced from PubChem (CID 15561769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).