C13H11F2I3O4 — CID 155617893
2,2-difluoro-4-methyl-3-(2,3,6-triiodobenzoyl)oxypentanoic acid (PubChem CID 155617893) has the molecular formula C13H11F2I3O4 and a molecular weight of 649.93 g/mol. Its IUPAC name is 2,2-difluoro-4-methyl-3-(2,3,6-triiodobenzoyl)oxypentanoic acid.
| Compound Name | 2,2-difluoro-4-methyl-3-(2,3,6-triiodobenzoyl)oxypentanoic acid |
|---|---|
| PubChem CID | 155617893 |
| Molecular Formula | C13H11F2I3O4 |
| Molecular Weight | 649.93 g/mol |
| Exact Mass | 649.78 |
| IUPAC Name | 2,2-difluoro-4-methyl-3-(2,3,6-triiodobenzoyl)oxypentanoic acid |
| SMILES | CC(C)C(OC(=O)c1c(I)ccc(I)c1I)C(F)(F)C(=O)O |
| InChI | InChI=1S/C13H11F2I3O4/c1-5(2)10(13(14,15)12(20)21)22-11(19)8-6(16)3-4-7(17)9(8)18/h3-5,10H,1-2H3,(H,20,21) |
| InChIKey | OJYAFAGKAMXEDQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|