C26H32FNO2Si — CID 155617973
1-[(1S,3S)-3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 155617973) has the molecular formula C26H32FNO2Si and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-[(1S,3S)-3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 155617973 |
| Molecular Formula | C26H32FNO2Si |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[(1S,3S)-3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCCC[C@H]1Cc2cc(OC)ccc2[C@H](c2ccc(F)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C26H32FNO2Si/c1-6-7-8-22-17-20-18-23(30-2)13-14-24(20)26(19-9-11-21(27)12-10-19)28(22)25(29)15-16-31(3,4)5/h9-14,18,22,26H,6-8,17H2,1-5H3/t22-,26-/m0/s1 |
| InChIKey | JDFUHZPZBXPEQM-NVQXNPDNSA-N |
| XLogP | 5.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|