C26H39NO — CID 155618148
(9Z,12Z,15Z)-N-(2-phenylethyl)octadeca-9,12,15-trienamide (PubChem CID 155618148) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N-(2-phenylethyl)octadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N-(2-phenylethyl)octadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 155618148 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | (9Z,12Z,15Z)-N-(2-phenylethyl)octadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(28)27-24-23-25-20-17-16-18-21-25/h3-4,6-7,9-10,16-18,20-21H,2,5,8,11-15,19,22-24H2,1H3,(H,27,28)/b4-3-,7-6-,10-9- |
| InChIKey | NUUWMADFOQFENP-PDBXOOCHSA-N |
| XLogP | 6.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|