About (2E)-2,3-dimethyl-2-pentenenitrile
(2E)-2,3-dimethyl-2-pentenenitrile (PubChem CID 15561853) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is (E)-2,3-dimethylpent-2-enenitrile.
Molecular Properties
| Compound Name | (2E)-2,3-dimethyl-2-pentenenitrile |
| PubChem CID | 15561853 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (E)-2,3-dimethylpent-2-enenitrile |
| SMILES | CC/C(=C(\C)/C#N)/C |
| InChI | InChI=1S/C7H11N/c1-4-6(2)7(3)5-8/h4H2,1-3H3/b7-6+ |
| InChIKey | AJPJASLUZXRMMI-VOTSOKGWSA-N |
| XLogP | 2.20 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | 145 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2,3-dimethyl-2-pentenenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2,3-dimethyl-2-pentenenitrile?
The IUPAC name of (2E)-2,3-dimethyl-2-pentenenitrile (CID 15561853) is (E)-2,3-dimethylpent-2-enenitrile.
What is the SMILES notation for (2E)-2,3-dimethyl-2-pentenenitrile?
The canonical SMILES for (2E)-2,3-dimethyl-2-pentenenitrile is CC/C(=C(\C)/C#N)/C.
What is the InChIKey of (2E)-2,3-dimethyl-2-pentenenitrile?
The InChIKey is AJPJASLUZXRMMI-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H11N/c1-4-6(2)7(3)5-8/h4H2,1-3H3/b7-6+.
What are the key properties of (2E)-2,3-dimethyl-2-pentenenitrile?
(2E)-2,3-dimethyl-2-pentenenitrile has a molecular weight of 109.17 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2,3-dimethyl-2-pentenenitrile is sourced from PubChem (CID 15561853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).