About sodium;carbanide;N,N-di(ethyl)propan-2-amine
sodium;carbanide;N,N-di(ethyl)propan-2-amine (PubChem CID 155618842) has the molecular formula C8H18NNa-2
and a molecular weight of 151.23 g/mol. Its IUPAC name is sodium;carbanide;N,N-di(ethyl)propan-2-amine.
Molecular Properties
| Compound Name | sodium;carbanide;N,N-di(ethyl)propan-2-amine |
| PubChem CID | 155618842 |
| Molecular Formula | C8H18NNa-2 |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.13 |
| IUPAC Name | sodium;carbanide;N,N-di(ethyl)propan-2-amine |
| SMILES | [CH2-]CN(C[CH2-])C(C)C.[CH3-].[Na+] |
| InChI | InChI=1S/C7H15N.CH3.Na/c1-5-8(6-2)7(3)4;;/h7H,1-2,5-6H2,3-4H3;1H3;/q-2;-1;+1 |
| InChIKey | GCUFDVUVCGXYMP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbanide;N,N-di(ethyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbanide;N,N-di(ethyl)propan-2-amine?
The IUPAC name of sodium;carbanide;N,N-di(ethyl)propan-2-amine (CID 155618842) is sodium;carbanide;N,N-di(ethyl)propan-2-amine.
What is the SMILES notation for sodium;carbanide;N,N-di(ethyl)propan-2-amine?
The canonical SMILES for sodium;carbanide;N,N-di(ethyl)propan-2-amine is [CH2-]CN(C[CH2-])C(C)C.[CH3-].[Na+].
What is the InChIKey of sodium;carbanide;N,N-di(ethyl)propan-2-amine?
The InChIKey is GCUFDVUVCGXYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.CH3.Na/c1-5-8(6-2)7(3)4;;/h7H,1-2,5-6H2,3-4H3;1H3;/q-2;-1;+1.
What are the key properties of sodium;carbanide;N,N-di(ethyl)propan-2-amine?
sodium;carbanide;N,N-di(ethyl)propan-2-amine has a molecular weight of 151.23 g/mol, XLogP of -1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbanide;N,N-di(ethyl)propan-2-amine is sourced from PubChem (CID 155618842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).