C8H18NNa-2 — CID 155618842
sodium;carbanide;N,N-di(ethyl)propan-2-amine (PubChem CID 155618842) has the molecular formula C8H18NNa-2 and a molecular weight of 151.23 g/mol. Its IUPAC name is sodium;carbanide;N,N-di(ethyl)propan-2-amine.
| Compound Name | sodium;carbanide;N,N-di(ethyl)propan-2-amine |
|---|---|
| PubChem CID | 155618842 |
| Molecular Formula | C8H18NNa-2 |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.13 |
| IUPAC Name | sodium;carbanide;N,N-di(ethyl)propan-2-amine |
| SMILES | [CH2-]CN(C[CH2-])C(C)C.[CH3-].[Na+] |
| InChI | InChI=1S/C7H15N.CH3.Na/c1-5-8(6-2)7(3)4;;/h7H,1-2,5-6H2,3-4H3;1H3;/q-2;-1;+1 |
| InChIKey | GCUFDVUVCGXYMP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|