C25H42O6Si — CID 155618874
(1'R,4'S,5'S,8'S,9'R)-4'-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6',9'-dimethylspiro[1,3-dioxolane-2,12'-2-oxatricyclo[6.5.0.01,5]tridecane]-3',7'-dione (PubChem CID 155618874) has the molecular formula C25H42O6Si and a molecular weight of 466.69 g/mol. Its IUPAC name is (1'R,4'S,5'S,8'S,9'R)-4'-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6',9'-dimethylspiro[1,3-dioxolane-2,12'-2-oxatricyclo[6.5.0.01,5]tridecane]-3',7'-dione.
| Compound Name | (1'R,4'S,5'S,8'S,9'R)-4'-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6',9'-dimethylspiro[1,3-dioxolane-2,12'-2-oxatricyclo[6.5.0.01,5]tridecane]-3',7'-dione |
|---|---|
| PubChem CID | 155618874 |
| Molecular Formula | C25H42O6Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (1'R,4'S,5'S,8'S,9'R)-4'-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6',9'-dimethylspiro[1,3-dioxolane-2,12'-2-oxatricyclo[6.5.0.01,5]tridecane]-3',7'-dione |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)O[C@@]23CC4(CC[C@@H](C)[C@@H]2C(=O)C(C)[C@@H]13)OCCO4 |
| InChI | InChI=1S/C25H42O6Si/c1-15-9-10-24(28-11-12-29-24)14-25-19(15)21(26)17(3)20(25)18(22(27)31-25)16(2)13-30-32(7,8)23(4,5)6/h15-20H,9-14H2,1-8H3/t15-,16?,17?,18+,19-,20+,25+/m1/s1 |
| InChIKey | YHBZHIOWNNJSPE-GHVWJFPVSA-N |
| XLogP | 4.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|