C30H40ClN5O8S3 — CID 155618958
2-[2-[3-[[3-chloro-2-methyl-4-[2-[3-(3-methyl-4-pyridinyl)phenyl]propan-2-yl]phenyl]sulfamoyl]propylsulfamoyl]ethylcarbamoylamino]ethanesulfonic acid (PubChem CID 155618958) has the molecular formula C30H40ClN5O8S3 and a molecular weight of 730.33 g/mol. Its IUPAC name is 2-[2-[3-[[3-chloro-2-methyl-4-[2-[3-(3-methyl-4-pyridinyl)phenyl]propan-2-yl]phenyl]sulfamoyl]propylsulfamoyl]ethylcarbamoylamino]ethanesulfonic acid.
| Compound Name | 2-[2-[3-[[3-chloro-2-methyl-4-[2-[3-(3-methyl-4-pyridinyl)phenyl]propan-2-yl]phenyl]sulfamoyl]propylsulfamoyl]ethylcarbamoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 155618958 |
| Molecular Formula | C30H40ClN5O8S3 |
| Molecular Weight | 730.33 g/mol |
| Exact Mass | 729.17 |
| IUPAC Name | 2-[2-[3-[[3-chloro-2-methyl-4-[2-[3-(3-methyl-4-pyridinyl)phenyl]propan-2-yl]phenyl]sulfamoyl]propylsulfamoyl]ethylcarbamoylamino]ethanesulfonic acid |
| SMILES | Cc1cnccc1-c1cccc(C(C)(C)c2ccc(NS(=O)(=O)CCCNS(=O)(=O)CCNC(=O)NCCS(=O)(=O)O)c(C)c2Cl)c1 |
| InChI | InChI=1S/C30H40ClN5O8S3/c1-21-20-32-13-11-25(21)23-7-5-8-24(19-23)30(3,4)26-9-10-27(22(2)28(26)31)36-46(40,41)16-6-12-35-45(38,39)17-14-33-29(37)34-15-18-47(42,43)44/h5,7-11,13,19-20,35-36H,6,12,14-18H2,1-4H3,(H2,33,34,37)(H,42,43,44) |
| InChIKey | XSHFDEJRRRUVQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 200.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|