C17H20N6O2+2 — CID 155619030
4-[(1,3-dimethyl-1H-benzimidazole-1,3-diium-2-yl)diazenyl]-N,N-dimethyl-3-nitroaniline (PubChem CID 155619030) has the molecular formula C17H20N6O2+2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-1H-benzimidazole-1,3-diium-2-yl)diazenyl]-N,N-dimethyl-3-nitroaniline.
| Compound Name | 4-[(1,3-dimethyl-1H-benzimidazole-1,3-diium-2-yl)diazenyl]-N,N-dimethyl-3-nitroaniline |
|---|---|
| PubChem CID | 155619030 |
| Molecular Formula | C17H20N6O2+2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[(1,3-dimethyl-1H-benzimidazole-1,3-diium-2-yl)diazenyl]-N,N-dimethyl-3-nitroaniline |
| SMILES | CN(C)c1ccc(/N=N/C2=[N+](C)c3ccccc3[NH+]2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N6O2/c1-20(2)12-9-10-13(16(11-12)23(24)25)18-19-17-21(3)14-7-5-6-8-15(14)22(17)4/h5-11H,1-4H3/q+1/p+1 |
| InChIKey | YBCORWHTSHYOCV-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|