C27H56O6Si — CID 155619158
[(2R,3R,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8-trimethyltridecan-5-yl] propanoate (PubChem CID 155619158) has the molecular formula C27H56O6Si and a molecular weight of 504.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8-trimethyltridecan-5-yl] propanoate.
| Compound Name | [(2R,3R,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8-trimethyltridecan-5-yl] propanoate |
|---|---|
| PubChem CID | 155619158 |
| Molecular Formula | C27H56O6Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | [(2R,3R,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8-trimethyltridecan-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H](CC[C@H](C)[C@H](C[C@@H](CC)O[Si](C)(C)C(C)(C)C)OC)[C@H](C)[C@H](OC)[C@H](C)CO |
| InChI | InChI=1S/C27H56O6Si/c1-13-22(33-34(11,12)27(6,7)8)17-24(30-9)19(3)15-16-23(32-25(29)14-2)21(5)26(31-10)20(4)18-28/h19-24,26,28H,13-18H2,1-12H3/t19-,20+,21-,22+,23+,24-,26+/m0/s1 |
| InChIKey | GKFGXXGAJCSFKO-SNKKNRKISA-N |
| XLogP | 6.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|