C29H60O6Si — CID 155619160
[(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] 2-methylpropanoate (PubChem CID 155619160) has the molecular formula C29H60O6Si and a molecular weight of 532.88 g/mol. Its IUPAC name is [(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155619160 |
| Molecular Formula | C29H60O6Si |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.42 |
| IUPAC Name | [(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] 2-methylpropanoate |
| SMILES | CO[C@@H]([C@@H](C)[C@@H](CC[C@H](C)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)OC)OC(=O)C(C)C)[C@H](C)CO |
| InChI | InChI=1S/C29H60O6Si/c1-19(2)25(35-36(13,14)29(8,9)10)17-26(32-11)21(5)15-16-24(34-28(31)20(3)4)23(7)27(33-12)22(6)18-30/h19-27,30H,15-18H2,1-14H3/t21-,22+,23-,24+,25-,26-,27+/m0/s1 |
| InChIKey | IABJGOJMKPVMPC-ZRYYVXAZSA-N |
| XLogP | 6.70 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|