C22H46NO7P — CID 155619215
(3-heptanoyloxy-2-heptoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 155619215) has the molecular formula C22H46NO7P and a molecular weight of 467.58 g/mol. Its IUPAC name is (3-heptanoyloxy-2-heptoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | (3-heptanoyloxy-2-heptoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 155619215 |
| Molecular Formula | C22H46NO7P |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | (3-heptanoyloxy-2-heptoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCOC(COC(=O)CCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C22H46NO7P/c1-6-8-10-12-14-17-27-21(19-28-22(24)15-13-11-9-7-2)20-30-31(25,26)29-18-16-23(3,4)5/h21H,6-20H2,1-5H3 |
| InChIKey | BQBVNKQEZADQTL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|