C39H49FIrNO2- — CID 155619473
4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-methylbenzo[f]isoquinoline;iridium;(Z)-3,3,7,7-tetraethyl-6-hydroxynon-5-en-4-one (PubChem CID 155619473) has the molecular formula C39H49FIrNO2- and a molecular weight of 775.04 g/mol. Its IUPAC name is 4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-methylbenzo[f]isoquinoline;iridium;(Z)-3,3,7,7-tetraethyl-6-hydroxynon-5-en-4-one.
| Compound Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-methylbenzo[f]isoquinoline;iridium;(Z)-3,3,7,7-tetraethyl-6-hydroxynon-5-en-4-one |
|---|---|
| PubChem CID | 155619473 |
| Molecular Formula | C39H49FIrNO2- |
| Molecular Weight | 775.04 g/mol |
| Exact Mass | 775.34 |
| IUPAC Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-9-fluoro-8-methylbenzo[f]isoquinoline;iridium;(Z)-3,3,7,7-tetraethyl-6-hydroxynon-5-en-4-one |
| SMILES | CCC(CC)(CC)C(=O)/C=C(\O)C(CC)(CC)CC.Cc1[c-]c(-c2nccc3c2ccc2cc(C)c(F)cc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C22H17FN.C17H32O2.Ir/c1-13-8-14(2)10-17(9-13)22-19-5-4-16-11-15(3)21(23)12-20(16)18(19)6-7-24-22;1-7-16(8-2,9-3)14(18)13-15(19)17(10-4,11-5)12-6;/h4-9,11-12H,1-3H3;13,18H,7-12H2,1-6H3;/q-1;;/b;14-13-; |
| InChIKey | SRNQOTABDRVQDW-VWJHZPHBSA-N |
| XLogP | 11.35 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.04 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|