C19H19FN6 — CID 155619690
(3R,4R)-4-fluoro-1-[3-[(4-isocyanophenyl)methyl]imidazo[4,5-c]pyridin-2-yl]piperidin-3-amine (PubChem CID 155619690) has the molecular formula C19H19FN6 and a molecular weight of 350.40 g/mol. Its IUPAC name is (3R,4R)-4-fluoro-1-[3-[(4-isocyanophenyl)methyl]imidazo[4,5-c]pyridin-2-yl]piperidin-3-amine.
| Compound Name | (3R,4R)-4-fluoro-1-[3-[(4-isocyanophenyl)methyl]imidazo[4,5-c]pyridin-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 155619690 |
| Molecular Formula | C19H19FN6 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3R,4R)-4-fluoro-1-[3-[(4-isocyanophenyl)methyl]imidazo[4,5-c]pyridin-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CC[C@@H](F)[C@H](N)C3)nc3ccncc32)cc1 |
| InChI | InChI=1S/C19H19FN6/c1-22-14-4-2-13(3-5-14)11-26-18-10-23-8-6-17(18)24-19(26)25-9-7-15(20)16(21)12-25/h2-6,8,10,15-16H,7,9,11-12,21H2/t15-,16-/m1/s1 |
| InChIKey | CAZZPIOCFOTSGC-HZPDHXFCSA-N |
| XLogP | 2.91 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|