About methyl 5-oxohept-6-enoate
methyl 5-oxohept-6-enoate (PubChem CID 15561975) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl 5-oxohept-6-enoate.
Molecular Properties
| Compound Name | methyl 5-oxohept-6-enoate |
| PubChem CID | 15561975 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | methyl 5-oxohept-6-enoate |
| SMILES | C=CC(=O)CCCC(=O)OC |
| InChI | InChI=1S/C8H12O3/c1-3-7(9)5-4-6-8(10)11-2/h3H,1,4-6H2,2H3 |
| InChIKey | ONGNQDROOOWKJT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxohept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxohept-6-enoate?
The IUPAC name of methyl 5-oxohept-6-enoate (CID 15561975) is methyl 5-oxohept-6-enoate.
What is the SMILES notation for methyl 5-oxohept-6-enoate?
The canonical SMILES for methyl 5-oxohept-6-enoate is C=CC(=O)CCCC(=O)OC.
What is the InChIKey of methyl 5-oxohept-6-enoate?
The InChIKey is ONGNQDROOOWKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-3-7(9)5-4-6-8(10)11-2/h3H,1,4-6H2,2H3.
What are the key properties of methyl 5-oxohept-6-enoate?
methyl 5-oxohept-6-enoate has a molecular weight of 156.18 g/mol, XLogP of 1.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxohept-6-enoate is sourced from PubChem (CID 15561975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).