C46H64O12 — CID 155619842
3-O-[2-[(3-methoxy-3-oxopropanoyl)oxymethyl]-2-[[2-[(4-methyl-3-oxopent-4-enoxy)methyl]-4-[4-[(4-pentylcyclohexyl)methoxy]phenyl]phenoxy]methyl]pentyl] 1-O-methyl propanedioate (PubChem CID 155619842) has the molecular formula C46H64O12 and a molecular weight of 809.01 g/mol. Its IUPAC name is 3-O-[2-[(3-methoxy-3-oxopropanoyl)oxymethyl]-2-[[2-[(4-methyl-3-oxopent-4-enoxy)methyl]-4-[4-[(4-pentylcyclohexyl)methoxy]phenyl]phenoxy]methyl]pentyl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[2-[(3-methoxy-3-oxopropanoyl)oxymethyl]-2-[[2-[(4-methyl-3-oxopent-4-enoxy)methyl]-4-[4-[(4-pentylcyclohexyl)methoxy]phenyl]phenoxy]methyl]pentyl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 155619842 |
| Molecular Formula | C46H64O12 |
| Molecular Weight | 809.01 g/mol |
| Exact Mass | 808.44 |
| IUPAC Name | 3-O-[2-[(3-methoxy-3-oxopropanoyl)oxymethyl]-2-[[2-[(4-methyl-3-oxopent-4-enoxy)methyl]-4-[4-[(4-pentylcyclohexyl)methoxy]phenyl]phenoxy]methyl]pentyl] 1-O-methyl propanedioate |
| SMILES | C=C(C)C(=O)CCOCc1cc(-c2ccc(OCC3CCC(CCCCC)CC3)cc2)ccc1OCC(CCC)(COC(=O)CC(=O)OC)COC(=O)CC(=O)OC |
| InChI | InChI=1S/C46H64O12/c1-7-9-10-11-34-12-14-35(15-13-34)28-55-39-19-16-36(17-20-39)37-18-21-41(38(25-37)29-54-24-22-40(47)33(3)4)56-30-46(23-8-2,31-57-44(50)26-42(48)52-5)32-58-45(51)27-43(49)53-6/h16-21,25,34-35H,3,7-15,22-24,26-32H2,1-2,4-6H3 |
| InChIKey | WJFWCPDCRMSQDL-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.01 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|