C20H22N2 — CID 15562029
2,2,5,5-tetramethyl-3,6-diphenylpyrazine (PubChem CID 15562029) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3,6-diphenylpyrazine.
| Compound Name | 2,2,5,5-tetramethyl-3,6-diphenylpyrazine |
|---|---|
| PubChem CID | 15562029 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2,2,5,5-tetramethyl-3,6-diphenylpyrazine |
| SMILES | CC1(C)N=C(c2ccccc2)C(C)(C)N=C1c1ccccc1 |
| InChI | InChI=1S/C20H22N2/c1-19(2)17(15-11-7-5-8-12-15)22-20(3,4)18(21-19)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | CZDBYKZOPVIRCW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |