C26H27N6O+ — CID 155620818
2-[4-[4-[[8-(3-aminophenyl)-6H-quinazolin-6-ylium-2-yl]amino]phenyl]piperazin-1-yl]ethanol (PubChem CID 155620818) has the molecular formula C26H27N6O+ and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-[4-[4-[[8-(3-aminophenyl)-6H-quinazolin-6-ylium-2-yl]amino]phenyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-[[8-(3-aminophenyl)-6H-quinazolin-6-ylium-2-yl]amino]phenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 155620818 |
| Molecular Formula | C26H27N6O+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 2-[4-[4-[[8-(3-aminophenyl)-6H-quinazolin-6-ylium-2-yl]amino]phenyl]piperazin-1-yl]ethanol |
| SMILES | Nc1cccc(C2=C[C+]=Cc3cnc(Nc4ccc(N5CCN(CCO)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C26H27N6O/c27-21-5-1-3-19(17-21)24-6-2-4-20-18-28-26(30-25(20)24)29-22-7-9-23(10-8-22)32-13-11-31(12-14-32)15-16-33/h1,3-10,17-18,33H,11-16,27H2,(H,28,29,30)/q+1 |
| InChIKey | SCMVFQQSVLDQOM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|