C20H17N7O3 — CID 155621060
3-[[3-[(3R,5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-4-oxopyrazolo[5,1-f][1,2,4]triazine-5-carbonitrile (PubChem CID 155621060) has the molecular formula C20H17N7O3 and a molecular weight of 403.40 g/mol. Its IUPAC name is 3-[[3-[(3R,5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-4-oxopyrazolo[5,1-f][1,2,4]triazine-5-carbonitrile.
| Compound Name | 3-[[3-[(3R,5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-4-oxopyrazolo[5,1-f][1,2,4]triazine-5-carbonitrile |
|---|---|
| PubChem CID | 155621060 |
| Molecular Formula | C20H17N7O3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-[[3-[(3R,5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-4-oxopyrazolo[5,1-f][1,2,4]triazine-5-carbonitrile |
| SMILES | Cc1ccc([C@H]2C[C@H](c3noc(Cn4cnn5ncc(C#N)c5c4=O)n3)CO2)cc1 |
| InChI | InChI=1S/C20H17N7O3/c1-12-2-4-13(5-3-12)16-6-14(10-29-16)19-24-17(30-25-19)9-26-11-23-27-18(20(26)28)15(7-21)8-22-27/h2-5,8,11,14,16H,6,9-10H2,1H3/t14-,16+/m0/s1 |
| InChIKey | NEPXYLQYFDSLPD-GOEBONIOSA-N |
| XLogP | 1.75 |
| TPSA | 124.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |