About CID 155622018
CID 155622018 (PubChem CID 155622018) has the molecular formula C37H43IrN14Si2-5
and a molecular weight of 932.24 g/mol.
Molecular Properties
| Compound Name | CID 155622018 |
| PubChem CID | 155622018 |
| Molecular Formula | C37H43IrN14Si2-5 |
| Molecular Weight | 932.24 g/mol |
| Exact Mass | 932.30 |
| IUPAC Name | — |
| SMILES | Cn1n[n+]([Si](C)(C)C)[c-]c1-c1[c-]n([Si](C)(C)C)nn1.[Ir].[c-]1ccccc1N1[CH-]N(CCCCN2[CH-]N(c3[c-]cccc3)c3nccnc32)c2nccnc21 |
| InChI | InChI=1S/C26H22N8.C11H21N6Si2.Ir/c1-3-9-21(10-4-1)33-19-31(23-25(33)29-15-13-27-23)17-7-8-18-32-20-34(22-11-5-2-6-12-22)26-24(32)28-14-16-30-26;1-15-11(9-17(14-15)19(5,6)7)10-8-16(13-12-10)18(2,3)4;/h1-6,9,11,13-16,19-20H,7-8,17-18H2;1-7H3;/q-4;-1; |
| InChIKey | VGEDKNIZWOYMHU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 116.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 932.24 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155622018 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155622018?
The IUPAC name of CID 155622018 (CID 155622018) is not available.
What is the SMILES notation for CID 155622018?
The canonical SMILES for CID 155622018 is Cn1n[n+]([Si](C)(C)C)[c-]c1-c1[c-]n([Si](C)(C)C)nn1.[Ir].[c-]1ccccc1N1[CH-]N(CCCCN2[CH-]N(c3[c-]cccc3)c3nccnc32)c2nccnc21.
What is the InChIKey of CID 155622018?
The InChIKey is VGEDKNIZWOYMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N8.C11H21N6Si2.Ir/c1-3-9-21(10-4-1)33-19-31(23-25(33)29-15-13-27-23)17-7-8-18-32-20-34(22-11-5-2-6-12-22)26-24(32)28-14-16-30-26;1-15-11(9-17(14-15)19(5,6)7)10-8-16(13-12-10)18(2,3)4;/h1-6,9,11,13-16,19-20H,7-8,17-18H2;1-7H3;/q-4;-1;.
What are the key properties of CID 155622018?
CID 155622018 has a molecular weight of 932.24 g/mol, XLogP of 5.43, 10 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155622018 is sourced from PubChem (CID 155622018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).