About (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide
(4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide (PubChem CID 155622219) has the molecular formula C7H14F3NOS
and a molecular weight of 217.26 g/mol. Its IUPAC name is (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide.
Molecular Properties
| Compound Name | (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide |
| PubChem CID | 155622219 |
| Molecular Formula | C7H14F3NOS |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide |
| SMILES | CC(C[C@@H](C)CC(F)(F)F)S(N)=O |
| InChI | InChI=1S/C7H14F3NOS/c1-5(4-7(8,9)10)3-6(2)13(11)12/h5-6H,3-4,11H2,1-2H3/t5-,6?,13?/m1/s1 |
| InChIKey | BTHFBFJTWLTPRO-VNFFJNKYSA-N |
| XLogP | 1.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide?
The IUPAC name of (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide (CID 155622219) is (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide.
What is the SMILES notation for (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide?
The canonical SMILES for (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide is CC(C[C@@H](C)CC(F)(F)F)S(N)=O.
What is the InChIKey of (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide?
The InChIKey is BTHFBFJTWLTPRO-VNFFJNKYSA-N. The full InChI is InChI=1S/C7H14F3NOS/c1-5(4-7(8,9)10)3-6(2)13(11)12/h5-6H,3-4,11H2,1-2H3/t5-,6?,13?/m1/s1.
What are the key properties of (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide?
(4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide has a molecular weight of 217.26 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6,6,6-trifluoro-4-methylhexane-2-sulfinamide is sourced from PubChem (CID 155622219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).