C24H22ClF5N8O3 — CID 155622459
3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-(3,3-difluorocyclobutyl)pyridine-2-carboxamide (PubChem CID 155622459) has the molecular formula C24H22ClF5N8O3 and a molecular weight of 600.94 g/mol. Its IUPAC name is 3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-(3,3-difluorocyclobutyl)pyridine-2-carboxamide.
| Compound Name | 3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-(3,3-difluorocyclobutyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155622459 |
| Molecular Formula | C24H22ClF5N8O3 |
| Molecular Weight | 600.94 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-(3,3-difluorocyclobutyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1)N(C[C@@H](O)C(F)(F)F)C(=O)NCc1ncn(-c2cccnc2C(=O)NC2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C24H22ClF5N8O3/c25-14-5-3-13(4-6-14)20(31)37(11-17(39)24(28,29)30)22(41)33-10-18-34-12-38(36-18)16-2-1-7-32-19(16)21(40)35-15-8-23(26,27)9-15/h1-7,12,15,17,31,39H,8-11H2,(H,33,41)(H,35,40)/b31-20+/t17-/m1/s1 |
| InChIKey | IEFWCMMMVDVTNV-XVVPQNFISA-N |
| XLogP | 3.30 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.94 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|