C23H22ClF3N8O3 — CID 155622486
3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-cyclopropylpyridine-2-carboxamide (PubChem CID 155622486) has the molecular formula C23H22ClF3N8O3 and a molecular weight of 550.93 g/mol. Its IUPAC name is 3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-cyclopropylpyridine-2-carboxamide.
| Compound Name | 3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-cyclopropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155622486 |
| Molecular Formula | C23H22ClF3N8O3 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 3-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-cyclopropylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1)N(C[C@@H](O)C(F)(F)F)C(=O)NCc1ncn(-c2cccnc2C(=O)NC2CC2)n1 |
| InChI | InChI=1S/C23H22ClF3N8O3/c24-14-5-3-13(4-6-14)20(28)34(11-17(36)23(25,26)27)22(38)30-10-18-31-12-35(33-18)16-2-1-9-29-19(16)21(37)32-15-7-8-15/h1-6,9,12,15,17,28,36H,7-8,10-11H2,(H,30,38)(H,32,37)/b28-20+/t17-/m1/s1 |
| InChIKey | AORAQWLJBZNRGB-JKKLTRFYSA-N |
| XLogP | 2.67 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|