About 4-(chloromethyl)-2,3-dihydro-1H-indene
4-(chloromethyl)-2,3-dihydro-1H-indene (PubChem CID 15562322) has the molecular formula C10H11Cl
and a molecular weight of 166.65 g/mol. Its IUPAC name is 4-(chloromethyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,3-dihydro-1H-indene |
| PubChem CID | 15562322 |
| Molecular Formula | C10H11Cl |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4-(chloromethyl)-2,3-dihydro-1H-indene |
| SMILES | ClCc1cccc2c1CCC2 |
| InChI | InChI=1S/C10H11Cl/c11-7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5H,2,4,6-7H2 |
| InChIKey | BZLIAEVSPAPOPT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,3-dihydro-1H-indene?
The IUPAC name of 4-(chloromethyl)-2,3-dihydro-1H-indene (CID 15562322) is 4-(chloromethyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for 4-(chloromethyl)-2,3-dihydro-1H-indene?
The canonical SMILES for 4-(chloromethyl)-2,3-dihydro-1H-indene is ClCc1cccc2c1CCC2.
What is the InChIKey of 4-(chloromethyl)-2,3-dihydro-1H-indene?
The InChIKey is BZLIAEVSPAPOPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl/c11-7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5H,2,4,6-7H2.
What are the key properties of 4-(chloromethyl)-2,3-dihydro-1H-indene?
4-(chloromethyl)-2,3-dihydro-1H-indene has a molecular weight of 166.65 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 15562322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).