C18H20ClFN2O2 — CID 155623335
1-[(3aR,4R,6R,6aS)-4-ethenyl-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-4-chloro-7-fluoropyrrolo[3,2-c]pyridine (PubChem CID 155623335) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aS)-4-ethenyl-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-4-chloro-7-fluoropyrrolo[3,2-c]pyridine.
| Compound Name | 1-[(3aR,4R,6R,6aS)-4-ethenyl-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-4-chloro-7-fluoropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 155623335 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[(3aR,4R,6R,6aS)-4-ethenyl-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-4-chloro-7-fluoropyrrolo[3,2-c]pyridine |
| SMILES | C=C[C@@]1(C)C[C@@H](n2ccc3c(Cl)ncc(F)c32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H20ClFN2O2/c1-5-18(4)8-12(14-15(18)24-17(2,3)23-14)22-7-6-10-13(22)11(20)9-21-16(10)19/h5-7,9,12,14-15H,1,8H2,2-4H3/t12-,14+,15+,18+/m1/s1 |
| InChIKey | BOEQRMNUPBZASX-FHIHXZLISA-N |
| XLogP | 4.49 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|