C15H28O3Si — CID 155623340
[(3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy-triethylsilane (PubChem CID 155623340) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is [(3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy-triethylsilane.
| Compound Name | [(3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 155623340 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [(3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@H](C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H28O3Si/c1-7-19(8-2,9-3)18-12-10-11(4)13-14(12)17-15(5,6)16-13/h10-11,13-14H,7-9H2,1-6H3/t11-,13+,14-/m0/s1 |
| InChIKey | KPVQMDJYCNEAMU-YUTCNCBUSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|