C32H38FN5O4 — CID 155623410
[(1S,2R,3S,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[2-(2-aminoquinolin-6-yl)ethyl]-3-methyl-2-(2-methylpropanoyloxy)cyclopentyl] 2-methylpropanoate (PubChem CID 155623410) has the molecular formula C32H38FN5O4 and a molecular weight of 575.69 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[2-(2-aminoquinolin-6-yl)ethyl]-3-methyl-2-(2-methylpropanoyloxy)cyclopentyl] 2-methylpropanoate.
| Compound Name | [(1S,2R,3S,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[2-(2-aminoquinolin-6-yl)ethyl]-3-methyl-2-(2-methylpropanoyloxy)cyclopentyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155623410 |
| Molecular Formula | C32H38FN5O4 |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | [(1S,2R,3S,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[2-(2-aminoquinolin-6-yl)ethyl]-3-methyl-2-(2-methylpropanoyloxy)cyclopentyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](n2ccc3c(N)ncc(F)c32)C[C@](C)(CCc2ccc3nc(N)ccc3c2)[C@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C32H38FN5O4/c1-17(2)30(39)41-27-24(38-13-11-21-26(38)22(33)16-36-29(21)35)15-32(5,28(27)42-31(40)18(3)4)12-10-19-6-8-23-20(14-19)7-9-25(34)37-23/h6-9,11,13-14,16-18,24,27-28H,10,12,15H2,1-5H3,(H2,34,37)(H2,35,36)/t24-,27+,28+,32+/m1/s1 |
| InChIKey | PNNUCMZEVWPWNT-JUAMTCFWSA-N |
| XLogP | 5.61 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |