C30H31F5O6S2 — CID 155623541
4-[4-[[4-(5,5-difluoro-2-methyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate (PubChem CID 155623541) has the molecular formula C30H31F5O6S2 and a molecular weight of 646.70 g/mol. Its IUPAC name is 4-[4-[[4-(5,5-difluoro-2-methyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate.
| Compound Name | 4-[4-[[4-(5,5-difluoro-2-methyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 155623541 |
| Molecular Formula | C30H31F5O6S2 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | 4-[4-[[4-(5,5-difluoro-2-methyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate |
| SMILES | CC(C)C1OC(C)(c2ccc([S+](c3ccccc3)c3ccc(OCCC(F)C(F)(F)S(=O)(=O)[O-])cc3)cc2)OCC1(F)F |
| InChI | InChI=1S/C30H31F5O6S2/c1-20(2)27-29(32,33)19-40-28(3,41-27)21-9-13-24(14-10-21)42(23-7-5-4-6-8-23)25-15-11-22(12-16-25)39-18-17-26(31)30(34,35)43(36,37)38/h4-16,20,26-27H,17-19H2,1-3H3 |
| InChIKey | KRKGKCHFIGFMMI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|