C27H25F5O6S2 — CID 155623543
4-[4-[[4-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate (PubChem CID 155623543) has the molecular formula C27H25F5O6S2 and a molecular weight of 604.62 g/mol. Its IUPAC name is 4-[4-[[4-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate.
| Compound Name | 4-[4-[[4-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 155623543 |
| Molecular Formula | C27H25F5O6S2 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | 4-[4-[[4-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]-1,1,2-trifluorobutane-1-sulfonate |
| SMILES | CC1(c2ccc([S+](c3ccccc3)c3ccc(OCCC(F)C(F)(F)S(=O)(=O)[O-])cc3)cc2)OCC(F)(F)CO1 |
| InChI | InChI=1S/C27H25F5O6S2/c1-25(37-17-26(29,30)18-38-25)19-7-11-22(12-8-19)39(21-5-3-2-4-6-21)23-13-9-20(10-14-23)36-16-15-24(28)27(31,32)40(33,34)35/h2-14,24H,15-18H2,1H3 |
| InChIKey | GFLMLUFOJUPWIT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|