C27H27F3O6S2 — CID 155623545
1,1,2-trifluoro-4-[4-[[4-(2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate (PubChem CID 155623545) has the molecular formula C27H27F3O6S2 and a molecular weight of 568.64 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-[4-[[4-(2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate.
| Compound Name | 1,1,2-trifluoro-4-[4-[[4-(2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 155623545 |
| Molecular Formula | C27H27F3O6S2 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 1,1,2-trifluoro-4-[4-[[4-(2-methyl-1,3-dioxan-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate |
| SMILES | CC1(c2ccc([S+](c3ccccc3)c3ccc(OCCC(F)C(F)(F)S(=O)(=O)[O-])cc3)cc2)OCCCO1 |
| InChI | InChI=1S/C27H27F3O6S2/c1-26(35-17-5-18-36-26)20-8-12-23(13-9-20)37(22-6-3-2-4-7-22)24-14-10-21(11-15-24)34-19-16-25(28)27(29,30)38(31,32)33/h2-4,6-15,25H,5,16-19H2,1H3 |
| InChIKey | CPLLSMSXVYNMRZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|