C29H31F3O6S2 — CID 155623547
1,1,2-trifluoro-4-[4-[phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]phenoxy]butane-1-sulfonate (PubChem CID 155623547) has the molecular formula C29H31F3O6S2 and a molecular weight of 596.69 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-[4-[phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]phenoxy]butane-1-sulfonate.
| Compound Name | 1,1,2-trifluoro-4-[4-[phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 155623547 |
| Molecular Formula | C29H31F3O6S2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 1,1,2-trifluoro-4-[4-[phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]phenoxy]butane-1-sulfonate |
| SMILES | CC1(C)COC(C)(c2ccc([S+](c3ccccc3)c3ccc(OCCC(F)C(F)(F)S(=O)(=O)[O-])cc3)cc2)OC1 |
| InChI | InChI=1S/C29H31F3O6S2/c1-27(2)19-37-28(3,38-20-27)21-9-13-24(14-10-21)39(23-7-5-4-6-8-23)25-15-11-22(12-16-25)36-18-17-26(30)29(31,32)40(33,34)35/h4-16,26H,17-20H2,1-3H3 |
| InChIKey | PBLUKIPWTZFHNB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|