C27H20F8O7S2 — CID 155623554
1,1-difluoro-2-[4-[[4-(5,5,6,6,7,7-hexafluoro-2-methyl-1,3-dioxocan-2-yl)phenyl]-phenylsulfonio]phenoxy]-2-oxoethanesulfonate (PubChem CID 155623554) has the molecular formula C27H20F8O7S2 and a molecular weight of 672.57 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[[4-(5,5,6,6,7,7-hexafluoro-2-methyl-1,3-dioxocan-2-yl)phenyl]-phenylsulfonio]phenoxy]-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-[4-[[4-(5,5,6,6,7,7-hexafluoro-2-methyl-1,3-dioxocan-2-yl)phenyl]-phenylsulfonio]phenoxy]-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 155623554 |
| Molecular Formula | C27H20F8O7S2 |
| Molecular Weight | 672.57 g/mol |
| Exact Mass | 672.05 |
| IUPAC Name | 1,1-difluoro-2-[4-[[4-(5,5,6,6,7,7-hexafluoro-2-methyl-1,3-dioxocan-2-yl)phenyl]-phenylsulfonio]phenoxy]-2-oxoethanesulfonate |
| SMILES | CC1(c2ccc([S+](c3ccccc3)c3ccc(OC(=O)C(F)(F)S(=O)(=O)[O-])cc3)cc2)OCC(F)(F)C(F)(F)C(F)(F)CO1 |
| InChI | InChI=1S/C27H20F8O7S2/c1-23(40-15-24(28,29)27(34,35)25(30,31)16-41-23)17-7-11-20(12-8-17)43(19-5-3-2-4-6-19)21-13-9-18(10-14-21)42-22(36)26(32,33)44(37,38)39/h2-14H,15-16H2,1H3 |
| InChIKey | GRAOPMCEZHIUAN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|