C29H28F4O6S2 — CID 155623623
1,1,2,2-tetrafluoro-4-[4-[[4-(2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate (PubChem CID 155623623) has the molecular formula C29H28F4O6S2 and a molecular weight of 612.66 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[4-[[4-(2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[4-[[4-(2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 155623623 |
| Molecular Formula | C29H28F4O6S2 |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[4-[[4-(2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-2-yl)phenyl]-phenylsulfonio]phenoxy]butane-1-sulfonate |
| SMILES | CC1(c2ccc([S+](c3ccccc3)c3ccc(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])cc3)cc2)OC2CCCC2O1 |
| InChI | InChI=1S/C29H28F4O6S2/c1-27(38-25-8-5-9-26(25)39-27)20-10-14-23(15-11-20)40(22-6-3-2-4-7-22)24-16-12-21(13-17-24)37-19-18-28(30,31)29(32,33)41(34,35)36/h2-4,6-7,10-17,25-26H,5,8-9,18-19H2,1H3 |
| InChIKey | MCBPDWKOYAHTMQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|