About (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene
(5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene (PubChem CID 15562414) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene.
Molecular Properties
| Compound Name | (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene |
| PubChem CID | 15562414 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene |
| SMILES | C1=C\CCCc2ccc(cc2)CCC/1 |
| InChI | InChI=1S/C14H18/c1-2-4-6-8-14-11-9-13(10-12-14)7-5-3-1/h1-2,9-12H,3-8H2/b2-1- |
| InChIKey | FGKPGTMPKFMBDZ-UPHRSURJSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene?
The IUPAC name of (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene (CID 15562414) is (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene.
What is the SMILES notation for (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene?
The canonical SMILES for (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene is C1=C\CCCc2ccc(cc2)CCC/1.
What is the InChIKey of (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene?
The InChIKey is FGKPGTMPKFMBDZ-UPHRSURJSA-N. The full InChI is InChI=1S/C14H18/c1-2-4-6-8-14-11-9-13(10-12-14)7-5-3-1/h1-2,9-12H,3-8H2/b2-1-.
What are the key properties of (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene?
(5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene has a molecular weight of 186.30 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene is sourced from PubChem (CID 15562414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).