C14H23O12S- — CID 155624257
[(3R,4R,6S)-5-hydroxy-6-[[(3S,4S,8S)-4-hydroxy-3-methoxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-2-(hydroxymethyl)-4-methyloxan-3-yl] sulfate (PubChem CID 155624257) has the molecular formula C14H23O12S- and a molecular weight of 415.39 g/mol. Its IUPAC name is [(3R,4R,6S)-5-hydroxy-6-[[(3S,4S,8S)-4-hydroxy-3-methoxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-2-(hydroxymethyl)-4-methyloxan-3-yl] sulfate.
| Compound Name | [(3R,4R,6S)-5-hydroxy-6-[[(3S,4S,8S)-4-hydroxy-3-methoxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-2-(hydroxymethyl)-4-methyloxan-3-yl] sulfate |
|---|---|
| PubChem CID | 155624257 |
| Molecular Formula | C14H23O12S- |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [(3R,4R,6S)-5-hydroxy-6-[[(3S,4S,8S)-4-hydroxy-3-methoxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-2-(hydroxymethyl)-4-methyloxan-3-yl] sulfate |
| SMILES | CO[C@H]1OC2COC([C@H]2O[C@@H]2OC(CO)[C@H](OS(=O)(=O)[O-])[C@H](C)C2O)[C@@H]1O |
| InChI | InChI=1S/C14H24O12S/c1-5-8(16)14(23-6(3-15)10(5)26-27(18,19)20)25-11-7-4-22-12(11)9(17)13(21-2)24-7/h5-17H,3-4H2,1-2H3,(H,18,19,20)/p-1/t5-,6?,7?,8?,9+,10-,11+,12?,13+,14+/m1/s1 |
| InChIKey | KPQJGGQBDFPYDQ-LEOGATMASA-M |
| XLogP | -2.94 |
| TPSA | 173.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|